C13H14O3 — CID 544264
4,5,6,8-tetrahydro-3H-1-benzoxecine-2,7-dione (PubChem CID 544264) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 4,5,6,8-tetrahydro-3H-1-benzoxecine-2,7-dione.
| Compound Name | 4,5,6,8-tetrahydro-3H-1-benzoxecine-2,7-dione |
|---|---|
| PubChem CID | 544264 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4,5,6,8-tetrahydro-3H-1-benzoxecine-2,7-dione |
| SMILES | O=C1CCCCC(=O)Oc2ccccc2C1 |
| InChI | InChI=1S/C13H14O3/c14-11-6-2-4-8-13(15)16-12-7-3-1-5-10(12)9-11/h1,3,5,7H,2,4,6,8-9H2 |
| InChIKey | NWWQBOWBJPXIFD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|