C20H20O3S2 — CID 160956069
3,4-dihydrochromen-2-one;spiro[1,3-dithiolane-2,2'-3,4-dihydrochromene] (PubChem CID 160956069) has the molecular formula C20H20O3S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3,4-dihydrochromen-2-one;spiro[1,3-dithiolane-2,2'-3,4-dihydrochromene].
| Compound Name | 3,4-dihydrochromen-2-one;spiro[1,3-dithiolane-2,2'-3,4-dihydrochromene] |
|---|---|
| PubChem CID | 160956069 |
| Molecular Formula | C20H20O3S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3,4-dihydrochromen-2-one;spiro[1,3-dithiolane-2,2'-3,4-dihydrochromene] |
| SMILES | O=C1CCc2ccccc2O1.c1ccc2c(c1)CCC1(O2)SCCS1 |
| InChI | InChI=1S/C11H12OS2.C9H8O2/c1-2-4-10-9(3-1)5-6-11(12-10)13-7-8-14-11;10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4H,5-8H2;1-4H,5-6H2 |
| InChIKey | SWKBSPACZMEIED-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|