C15H14O3 — CID 174539962
2-(4-hydroxyphenyl)-3,4-dihydrochromen-2-ol (PubChem CID 174539962) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3,4-dihydrochromen-2-ol.
| Compound Name | 2-(4-hydroxyphenyl)-3,4-dihydrochromen-2-ol |
|---|---|
| PubChem CID | 174539962 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3,4-dihydrochromen-2-ol |
| SMILES | Oc1ccc(C2(O)CCc3ccccc3O2)cc1 |
| InChI | InChI=1S/C15H14O3/c16-13-7-5-12(6-8-13)15(17)10-9-11-3-1-2-4-14(11)18-15/h1-8,16-17H,9-10H2 |
| InChIKey | BACAMRBCACKYOQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |