About spiro[3H-1-benzofuran-2,1'-cyclopropane]
spiro[3H-1-benzofuran-2,1'-cyclopropane] (PubChem CID 146627371) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is spiro[3H-1-benzofuran-2,1'-cyclopropane].
Molecular Properties
| Compound Name | spiro[3H-1-benzofuran-2,1'-cyclopropane] |
| PubChem CID | 146627371 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | spiro[3H-1-benzofuran-2,1'-cyclopropane] |
| SMILES | c1ccc2c(c1)CC1(CC1)O2 |
| InChI | InChI=1S/C10H10O/c1-2-4-9-8(3-1)7-10(11-9)5-6-10/h1-4H,5-7H2 |
| InChIKey | QOPUCSAYMVEJFZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[3H-1-benzofuran-2,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-1-benzofuran-2,1'-cyclopropane]?
The IUPAC name of spiro[3H-1-benzofuran-2,1'-cyclopropane] (CID 146627371) is spiro[3H-1-benzofuran-2,1'-cyclopropane].
What is the SMILES notation for spiro[3H-1-benzofuran-2,1'-cyclopropane]?
The canonical SMILES for spiro[3H-1-benzofuran-2,1'-cyclopropane] is c1ccc2c(c1)CC1(CC1)O2.
What is the InChIKey of spiro[3H-1-benzofuran-2,1'-cyclopropane]?
The InChIKey is QOPUCSAYMVEJFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-2-4-9-8(3-1)7-10(11-9)5-6-10/h1-4H,5-7H2.
What are the key properties of spiro[3H-1-benzofuran-2,1'-cyclopropane]?
spiro[3H-1-benzofuran-2,1'-cyclopropane] has a molecular weight of 146.19 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-1-benzofuran-2,1'-cyclopropane] is sourced from PubChem (CID 146627371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).