C14H17NO — CID 105468819
spiro[3H-1-benzofuran-2,3'-8-azabicyclo[3.2.1]octane] (PubChem CID 105468819) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is spiro[3H-1-benzofuran-2,3'-8-azabicyclo[3.2.1]octane].
| Compound Name | spiro[3H-1-benzofuran-2,3'-8-azabicyclo[3.2.1]octane] |
|---|---|
| PubChem CID | 105468819 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | spiro[3H-1-benzofuran-2,3'-8-azabicyclo[3.2.1]octane] |
| SMILES | c1ccc2c(c1)CC1(CC3CCC(C1)N3)O2 |
| InChI | InChI=1S/C14H17NO/c1-2-4-13-10(3-1)7-14(16-13)8-11-5-6-12(9-14)15-11/h1-4,11-12,15H,5-9H2 |
| InChIKey | FIFOXQRJVMGTFN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |