C18H25NO — CID 58035370
1'-cyclohexylspiro[3H-1-benzofuran-2,4'-piperidine] (PubChem CID 58035370) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 1'-cyclohexylspiro[3H-1-benzofuran-2,4'-piperidine].
| Compound Name | 1'-cyclohexylspiro[3H-1-benzofuran-2,4'-piperidine] |
|---|---|
| PubChem CID | 58035370 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1'-cyclohexylspiro[3H-1-benzofuran-2,4'-piperidine] |
| SMILES | c1ccc2c(c1)CC1(CCN(C3CCCCC3)CC1)O2 |
| InChI | InChI=1S/C18H25NO/c1-2-7-16(8-3-1)19-12-10-18(11-13-19)14-15-6-4-5-9-17(15)20-18/h4-6,9,16H,1-3,7-8,10-14H2 |
| InChIKey | MTJCWLJBFJFFOI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |