C20H28N2O3 — CID 122619555
1'-cyclohexyl-N-hydroxyspiro[3,4-dihydrochromene-2,4'-piperidine]-7-carboxamide (PubChem CID 122619555) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1'-cyclohexyl-N-hydroxyspiro[3,4-dihydrochromene-2,4'-piperidine]-7-carboxamide.
| Compound Name | 1'-cyclohexyl-N-hydroxyspiro[3,4-dihydrochromene-2,4'-piperidine]-7-carboxamide |
|---|---|
| PubChem CID | 122619555 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1'-cyclohexyl-N-hydroxyspiro[3,4-dihydrochromene-2,4'-piperidine]-7-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)OC1(CC2)CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H28N2O3/c23-19(21-24)16-7-6-15-8-9-20(25-18(15)14-16)10-12-22(13-11-20)17-4-2-1-3-5-17/h6-7,14,17,24H,1-5,8-13H2,(H,21,23) |
| InChIKey | RTZXZBLETXQICY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|