C21H26N2O4 — CID 172692389
2-(1'-cyclopentyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide (PubChem CID 172692389) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(1'-cyclopentyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide.
| Compound Name | 2-(1'-cyclopentyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 172692389 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(1'-cyclopentyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide |
| SMILES | C=C(C(=O)NO)c1ccc2c(c1)C(=O)CC1(CCN(C3CCCC3)CC1)O2 |
| InChI | InChI=1S/C21H26N2O4/c1-14(20(25)22-26)15-6-7-19-17(12-15)18(24)13-21(27-19)8-10-23(11-9-21)16-4-2-3-5-16/h6-7,12,16,26H,1-5,8-11,13H2,(H,22,25) |
| InChIKey | BVVXDABWPHAAKU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|