C21H28N2O2S — CID 108781778
N-cyclohexyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide (PubChem CID 108781778) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is N-cyclohexyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide.
| Compound Name | N-cyclohexyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
|---|---|
| PubChem CID | 108781778 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-cyclohexyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
| SMILES | Cc1ccc2c(c1)C(=O)CC1(CCN(C(=S)NC3CCCCC3)CC1)O2 |
| InChI | InChI=1S/C21H28N2O2S/c1-15-7-8-19-17(13-15)18(24)14-21(25-19)9-11-23(12-10-21)20(26)22-16-5-3-2-4-6-16/h7-8,13,16H,2-6,9-12,14H2,1H3,(H,22,26) |
| InChIKey | TWLKLSVNMKFRTJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|