About N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide
N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide (PubChem CID 108781779) has the molecular formula C17H22N2O2S
and a molecular weight of 318.44 g/mol. Its IUPAC name is N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide.
Molecular Properties
| Compound Name | N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
| PubChem CID | 108781779 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
| SMILES | CCNC(=S)N1CCC2(CC1)CC(=O)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C17H22N2O2S/c1-3-18-16(22)19-8-6-17(7-9-19)11-14(20)13-10-12(2)4-5-15(13)21-17/h4-5,10H,3,6-9,11H2,1-2H3,(H,18,22) |
| InChIKey | ANRWQIODFMDVDP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide?
The IUPAC name of N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide (CID 108781779) is N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide.
What is the SMILES notation for N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide?
The canonical SMILES for N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide is CCNC(=S)N1CCC2(CC1)CC(=O)c1cc(C)ccc1O2.
What is the InChIKey of N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide?
The InChIKey is ANRWQIODFMDVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2S/c1-3-18-16(22)19-8-6-17(7-9-19)11-14(20)13-10-12(2)4-5-15(13)21-17/h4-5,10H,3,6-9,11H2,1-2H3,(H,18,22).
What are the key properties of N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide?
N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide has a molecular weight of 318.44 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide is sourced from PubChem (CID 108781779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).