C22H29ClN2O2S — CID 108781940
6-chloro-N-cyclohexyl-5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide (PubChem CID 108781940) has the molecular formula C22H29ClN2O2S and a molecular weight of 421.01 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide.
| Compound Name | 6-chloro-N-cyclohexyl-5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
|---|---|
| PubChem CID | 108781940 |
| Molecular Formula | C22H29ClN2O2S |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 6-chloro-N-cyclohexyl-5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
| SMILES | Cc1cc2c(c(C)c1Cl)C(=O)CC1(CCN(C(=S)NC3CCCCC3)CC1)O2 |
| InChI | InChI=1S/C22H29ClN2O2S/c1-14-12-18-19(15(2)20(14)23)17(26)13-22(27-18)8-10-25(11-9-22)21(28)24-16-6-4-3-5-7-16/h12,16H,3-11,13H2,1-2H3,(H,24,28) |
| InChIKey | KPNFKJUTEBGTTK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|