C15H18ClNO2 — CID 16643155
6-chloro-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 16643155) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 6-chloro-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 16643155 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-chloro-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc2c(c(C)c1Cl)C(=O)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C15H18ClNO2/c1-9-7-12-13(10(2)14(9)16)11(18)8-15(19-12)3-5-17-6-4-15/h7,17H,3-6,8H2,1-2H3 |
| InChIKey | RBLLLHQHNPFEEO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |