C15H22N2O2 — CID 68979628
azane;6,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 68979628) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is azane;6,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | azane;6,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 68979628 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | azane;6,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc2c(cc1C)C(=O)CC1(CCNCC1)O2.N |
| InChI | InChI=1S/C15H19NO2.H3N/c1-10-7-12-13(17)9-15(3-5-16-6-4-15)18-14(12)8-11(10)2;/h7-8,16H,3-6,9H2,1-2H3;1H3 |
| InChIKey | GJFCJUOPBQPABT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |