C13H15ClFNO2 — CID 68663303
6-fluorospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (PubChem CID 68663303) has the molecular formula C13H15ClFNO2 and a molecular weight of 271.72 g/mol. Its IUPAC name is 6-fluorospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride.
| Compound Name | 6-fluorospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
|---|---|
| PubChem CID | 68663303 |
| Molecular Formula | C13H15ClFNO2 |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-fluorospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| SMILES | Cl.O=C1CC2(CCNCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C13H14FNO2.ClH/c14-9-1-2-12-10(7-9)11(16)8-13(17-12)3-5-15-6-4-13;/h1-2,7,15H,3-6,8H2;1H |
| InChIKey | VITABEUPCHVIAC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |