(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid

C14H16N2O4 — CID 68984003

IUPAC(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid
SMILESO=C(O)Nc1ccc2c(c1)C(=O)CC1(CCNCC1)O2
InChIInChI=1S/C14H16N2O4/c17-11-8-14(3-5-15-6-4-14)20-12-2-1-9(7-10(11)12)16-13(18)19/h1-2,7,15-16H,3-6,8H2,(H,18,19)
InChIKeyOGRCNPRWDHLZFO-UHFFFAOYSA-N
MW276.29 g/mol
LogP1.86
Rot. Bonds1

About (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid

(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid (PubChem CID 68984003) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid.

Molecular Properties

Compound Name(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid
PubChem CID68984003
Molecular FormulaC14H16N2O4
Molecular Weight276.29 g/mol
Exact Mass276.11
IUPAC Name(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid
SMILESO=C(O)Nc1ccc2c(c1)C(=O)CC1(CCNCC1)O2
InChIInChI=1S/C14H16N2O4/c17-11-8-14(3-5-15-6-4-14)20-12-2-1-9(7-10(11)12)16-13(18)19/h1-2,7,15-16H,3-6,8H2,(H,18,19)
InChIKeyOGRCNPRWDHLZFO-UHFFFAOYSA-N
XLogP1.86
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 51.86
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid?
The IUPAC name of (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid (CID 68984003) is (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid.
What is the SMILES notation for (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid?
The canonical SMILES for (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid is O=C(O)Nc1ccc2c(c1)C(=O)CC1(CCNCC1)O2.
What is the InChIKey of (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid?
The InChIKey is OGRCNPRWDHLZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4/c17-11-8-14(3-5-15-6-4-14)20-12-2-1-9(7-10(11)12)16-13(18)19/h1-2,7,15-16H,3-6,8H2,(H,18,19).
What are the key properties of (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid?
(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid has a molecular weight of 276.29 g/mol, XLogP of 1.86, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid is sourced from PubChem (CID 68984003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).