C14H16N2O4 — CID 68984003
(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid (PubChem CID 68984003) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid.
| Compound Name | (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid |
|---|---|
| PubChem CID | 68984003 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid |
| SMILES | O=C(O)Nc1ccc2c(c1)C(=O)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C14H16N2O4/c17-11-8-14(3-5-15-6-4-14)20-12-2-1-9(7-10(11)12)16-13(18)19/h1-2,7,15-16H,3-6,8H2,(H,18,19) |
| InChIKey | OGRCNPRWDHLZFO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |