C20H19BrN2O3 — CID 100760356
6-bromo-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carboxamide (PubChem CID 100760356) has the molecular formula C20H19BrN2O3 and a molecular weight of 415.29 g/mol. Its IUPAC name is 6-bromo-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carboxamide.
| Compound Name | 6-bromo-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 100760356 |
| Molecular Formula | C20H19BrN2O3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 6-bromo-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carboxamide |
| SMILES | O=C1CC2(CCN(C(=O)Nc3ccccc3)CC2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C20H19BrN2O3/c21-14-6-7-18-16(12-14)17(24)13-20(26-18)8-10-23(11-9-20)19(25)22-15-4-2-1-3-5-15/h1-7,12H,8-11,13H2,(H,22,25) |
| InChIKey | PCQSZTVFRXSOCU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |