C18H22N2O3 — CID 69076705
6-(pyrrolidine-1-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 69076705) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 6-(pyrrolidine-1-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-(pyrrolidine-1-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 69076705 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-(pyrrolidine-1-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCNCC2)Oc2ccc(C(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C18H22N2O3/c21-15-12-18(5-7-19-8-6-18)23-16-4-3-13(11-14(15)16)17(22)20-9-1-2-10-20/h3-4,11,19H,1-2,5-10,12H2 |
| InChIKey | BXVLWYLLLUSMOM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |