C26H28ClN3O5 — CID 108735366
6-chloro-5,7-dimethyl-1'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108735366) has the molecular formula C26H28ClN3O5 and a molecular weight of 497.98 g/mol. Its IUPAC name is 6-chloro-5,7-dimethyl-1'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-5,7-dimethyl-1'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108735366 |
| Molecular Formula | C26H28ClN3O5 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 6-chloro-5,7-dimethyl-1'-(3-nitro-4-pyrrolidin-1-ylbenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc2c(c(C)c1Cl)C(=O)CC1(CCN(C(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)CC1)O2 |
| InChI | InChI=1S/C26H28ClN3O5/c1-16-13-22-23(17(2)24(16)27)21(31)15-26(35-22)7-11-29(12-8-26)25(32)18-5-6-19(20(14-18)30(33)34)28-9-3-4-10-28/h5-6,13-14H,3-4,7-12,15H2,1-2H3 |
| InChIKey | MPAJSSDWTOOTSG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|