C16H21NO — CID 143099821
ethene;spiro[1H-2-benzofuran-3,3'-8-azabicyclo[3.2.1]octane] (PubChem CID 143099821) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is ethene;spiro[1H-2-benzofuran-3,3'-8-azabicyclo[3.2.1]octane].
| Compound Name | ethene;spiro[1H-2-benzofuran-3,3'-8-azabicyclo[3.2.1]octane] |
|---|---|
| PubChem CID | 143099821 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | ethene;spiro[1H-2-benzofuran-3,3'-8-azabicyclo[3.2.1]octane] |
| SMILES | C=C.c1ccc2c(c1)COC21CC2CCC(C1)N2 |
| InChI | InChI=1S/C14H17NO.C2H4/c1-2-4-13-10(3-1)9-16-14(13)7-11-5-6-12(8-14)15-11;1-2/h1-4,11-12,15H,5-9H2;1-2H2 |
| InChIKey | HQEOTVKHILQEIU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|