About spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride
spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride (PubChem CID 66662035) has the molecular formula C11H14ClNO
and a molecular weight of 211.69 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride.
Molecular Properties
| Compound Name | spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride |
| PubChem CID | 66662035 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride |
| SMILES | Cl.c1ccc2c(c1)COC21CCNC1 |
| InChI | InChI=1S/C11H13NO.ClH/c1-2-4-10-9(3-1)7-13-11(10)5-6-12-8-11;/h1-4,12H,5-8H2;1H |
| InChIKey | GPPYAKUWMQPENX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride?
The IUPAC name of spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride (CID 66662035) is spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride.
What is the SMILES notation for spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride?
The canonical SMILES for spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride is Cl.c1ccc2c(c1)COC21CCNC1.
What is the InChIKey of spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride?
The InChIKey is GPPYAKUWMQPENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO.ClH/c1-2-4-10-9(3-1)7-13-11(10)5-6-12-8-11;/h1-4,12H,5-8H2;1H.
What are the key properties of spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride?
spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride has a molecular weight of 211.69 g/mol, XLogP of 1.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-2-benzofuran-3,3'-pyrrolidine];hydrochloride is sourced from PubChem (CID 66662035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).