C11H14N2O3S — CID 124618391
(3S)-spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-sulfonamide (PubChem CID 124618391) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is (3S)-spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-sulfonamide.
| Compound Name | (3S)-spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-sulfonamide |
|---|---|
| PubChem CID | 124618391 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (3S)-spiro[1H-2-benzofuran-3,3'-pyrrolidine]-1'-sulfonamide |
| SMILES | NS(=O)(=O)N1CC[C@]2(C1)OCc1ccccc12 |
| InChI | InChI=1S/C11H14N2O3S/c12-17(14,15)13-6-5-11(8-13)10-4-2-1-3-9(10)7-16-11/h1-4H,5-8H2,(H2,12,14,15)/t11-/m1/s1 |
| InChIKey | VEICYFFBCQTMDG-LLVKDONJSA-N |
| XLogP | 0.32 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |