C16H27NO — CID 163403209
ethane;spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 163403209) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | ethane;spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 163403209 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | ethane;spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | CC.CC.c1ccc2c(c1)COC21CCNCC1 |
| InChI | InChI=1S/C12H15NO.2C2H6/c1-2-4-11-10(3-1)9-14-12(11)5-7-13-8-6-12;2*1-2/h1-4,13H,5-9H2;2*1-2H3 |
| InChIKey | JMTRRQLNXGRWDH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |