C12H16N2O — CID 118174279
2-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] (PubChem CID 118174279) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine].
| Compound Name | 2-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] |
|---|---|
| PubChem CID | 118174279 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] |
| SMILES | Cc1ccc2c(n1)C1(CCNCC1)OC2 |
| InChI | InChI=1S/C12H16N2O/c1-9-2-3-10-8-15-12(11(10)14-9)4-6-13-7-5-12/h2-3,13H,4-8H2,1H3 |
| InChIKey | DRHXTOJGRWWWQM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |