C13H17N3O2 — CID 68899786
N-spiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-6-ylacetamide (PubChem CID 68899786) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-spiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-6-ylacetamide.
| Compound Name | N-spiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-6-ylacetamide |
|---|---|
| PubChem CID | 68899786 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-spiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-6-ylacetamide |
| SMILES | CC(=O)Nc1cc2c(cn1)COC21CCNCC1 |
| InChI | InChI=1S/C13H17N3O2/c1-9(17)16-12-6-11-10(7-15-12)8-18-13(11)2-4-14-5-3-13/h6-7,14H,2-5,8H2,1H3,(H,15,16,17) |
| InChIKey | WWIVGPWMRNKNJJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |