C11H14N2O — CID 46735163
spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] (PubChem CID 46735163) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine].
| Compound Name | spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] |
|---|---|
| PubChem CID | 46735163 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] |
| SMILES | c1cc2c(cn1)C1(CCNCC1)OC2 |
| InChI | InChI=1S/C11H14N2O/c1-4-13-7-10-9(1)8-14-11(10)2-5-12-6-3-11/h1,4,7,12H,2-3,5-6,8H2 |
| InChIKey | AYJYOTMPNCIHOG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |