About 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane]
2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] (PubChem CID 162728885) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane].
Molecular Properties
| Compound Name | 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] |
| PubChem CID | 162728885 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] |
| SMILES | Clc1ccc2c(n1)C1(CCOC1)OC2 |
| InChI | InChI=1S/C10H10ClNO2/c11-8-2-1-7-5-14-10(9(7)12-8)3-4-13-6-10/h1-2H,3-6H2 |
| InChIKey | LWZHGKUKULGCES-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane]?
The IUPAC name of 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] (CID 162728885) is 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane].
What is the SMILES notation for 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane]?
The canonical SMILES for 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] is Clc1ccc2c(n1)C1(CCOC1)OC2.
What is the InChIKey of 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane]?
The InChIKey is LWZHGKUKULGCES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO2/c11-8-2-1-7-5-14-10(9(7)12-8)3-4-13-6-10/h1-2H,3-6H2.
What are the key properties of 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane]?
2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] has a molecular weight of 211.65 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] is sourced from PubChem (CID 162728885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).