C10H10ClNO2 — CID 162728885
2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] (PubChem CID 162728885) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane].
| Compound Name | 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] |
|---|---|
| PubChem CID | 162728885 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-chlorospiro[5H-furo[3,4-b]pyridine-7,3'-oxolane] |
| SMILES | Clc1ccc2c(n1)C1(CCOC1)OC2 |
| InChI | InChI=1S/C10H10ClNO2/c11-8-2-1-7-5-14-10(9(7)12-8)3-4-13-6-10/h1-2H,3-6H2 |
| InChIKey | LWZHGKUKULGCES-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|