C11H13NO2 — CID 162728892
spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] (PubChem CID 162728892) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is spiro[5H-furo[3,4-b]pyridine-7,3'-oxane].
| Compound Name | spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] |
|---|---|
| PubChem CID | 162728892 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] |
| SMILES | c1cnc2c(c1)COC21CCCOC1 |
| InChI | InChI=1S/C11H13NO2/c1-3-9-7-14-11(10(9)12-5-1)4-2-6-13-8-11/h1,3,5H,2,4,6-8H2 |
| InChIKey | UMBMZOIGGWLIKW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |