About spiro[5H-furo[3,4-b]pyridine-7,3'-oxane]
spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] (PubChem CID 162728892) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is spiro[5H-furo[3,4-b]pyridine-7,3'-oxane].
Molecular Properties
| Compound Name | spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] |
| PubChem CID | 162728892 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] |
| SMILES | c1cnc2c(c1)COC21CCCOC1 |
| InChI | InChI=1S/C11H13NO2/c1-3-9-7-14-11(10(9)12-5-1)4-2-6-13-8-11/h1,3,5H,2,4,6-8H2 |
| InChIKey | UMBMZOIGGWLIKW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5H-furo[3,4-b]pyridine-7,3'-oxane]?
The IUPAC name of spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] (CID 162728892) is spiro[5H-furo[3,4-b]pyridine-7,3'-oxane].
What is the SMILES notation for spiro[5H-furo[3,4-b]pyridine-7,3'-oxane]?
The canonical SMILES for spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] is c1cnc2c(c1)COC21CCCOC1.
What is the InChIKey of spiro[5H-furo[3,4-b]pyridine-7,3'-oxane]?
The InChIKey is UMBMZOIGGWLIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-3-9-7-14-11(10(9)12-5-1)4-2-6-13-8-11/h1,3,5H,2,4,6-8H2.
What are the key properties of spiro[5H-furo[3,4-b]pyridine-7,3'-oxane]?
spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] has a molecular weight of 191.23 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5H-furo[3,4-b]pyridine-7,3'-oxane] is sourced from PubChem (CID 162728892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).