C20H26N2O5 — CID 101140723
9,12,15,18,21-pentaoxa-3,27-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene (PubChem CID 101140723) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 9,12,15,18,21-pentaoxa-3,27-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene.
| Compound Name | 9,12,15,18,21-pentaoxa-3,27-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene |
|---|---|
| PubChem CID | 101140723 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 9,12,15,18,21-pentaoxa-3,27-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene |
| SMILES | c1cnc2c(c1)COCCOCCOCCOCCOCc1cccnc1-2 |
| InChI | InChI=1S/C20H26N2O5/c1-3-17-15-26-13-11-24-9-7-23-8-10-25-12-14-27-16-18-4-2-6-22-20(18)19(17)21-5-1/h1-6H,7-16H2 |
| InChIKey | SJNGPDYVVCMQOW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |