C18H18N2O4 — CID 101089451
15,18,21,24-tetraoxa-6,9-diazatetracyclo[12.10.0.02,7.08,13]tetracosa-1(14),2(7),3,5,8(13),9,11-heptaene (PubChem CID 101089451) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 15,18,21,24-tetraoxa-6,9-diazatetracyclo[12.10.0.02,7.08,13]tetracosa-1(14),2(7),3,5,8(13),9,11-heptaene.
| Compound Name | 15,18,21,24-tetraoxa-6,9-diazatetracyclo[12.10.0.02,7.08,13]tetracosa-1(14),2(7),3,5,8(13),9,11-heptaene |
|---|---|
| PubChem CID | 101089451 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 15,18,21,24-tetraoxa-6,9-diazatetracyclo[12.10.0.02,7.08,13]tetracosa-1(14),2(7),3,5,8(13),9,11-heptaene |
| SMILES | c1cnc2c(c1)c1c(c3cccnc32)OCCOCCOCCO1 |
| InChI | InChI=1S/C18H18N2O4/c1-3-13-15(19-5-1)16-14(4-2-6-20-16)18-17(13)23-11-9-21-7-8-22-10-12-24-18/h1-6H,7-12H2 |
| InChIKey | BUCOIUXPAGXCEQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|