C14H10N2O2 — CID 101089450
2,3-dihydro-[1,4]dioxino[2,3-f][1,10]phenanthroline (PubChem CID 101089450) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-f][1,10]phenanthroline.
| Compound Name | 2,3-dihydro-[1,4]dioxino[2,3-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 101089450 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2,3-dihydro-[1,4]dioxino[2,3-f][1,10]phenanthroline |
| SMILES | c1cnc2c(c1)c1c(c3cccnc32)OCCO1 |
| InChI | InChI=1S/C14H10N2O2/c1-3-9-11(15-5-1)12-10(4-2-6-16-12)14-13(9)17-7-8-18-14/h1-6H,7-8H2 |
| InChIKey | UXBSPXYBSKTUNO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|