About 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene
11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene (PubChem CID 70245532) has the molecular formula C9H5NO
and a molecular weight of 143.14 g/mol. Its IUPAC name is 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene.
Analyze 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene?
The IUPAC name of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene (CID 70245532) is 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene.
What is the SMILES notation for 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene?
The canonical SMILES for 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene is c1cnc2c3ccc(o3)c2c1.
What is the InChIKey of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene?
The InChIKey is DHQNBBACWKTKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO/c1-2-6-7-3-4-8(11-7)9(6)10-5-1/h1-5H.
What are the key properties of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene?
11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene has a molecular weight of 143.14 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-1,3,5,7,9-pentaene is sourced from PubChem (CID 70245532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).