C11H6BNO — CID 90291971
CID 90291971 (PubChem CID 90291971) has the molecular formula C11H6BNO and a molecular weight of 178.99 g/mol.
| Compound Name | CID 90291971 |
|---|---|
| PubChem CID | 90291971 |
| Molecular Formula | C11H6BNO |
| Molecular Weight | 178.99 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2oc3cccnc3c2c1 |
| InChI | InChI=1S/C11H6BNO/c12-7-3-4-9-8(6-7)11-10(14-9)2-1-5-13-11/h1-6H |
| InChIKey | JTPATJWGBISSJO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.99 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|