C15H9NO — CID 138661052
17-oxa-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 138661052) has the molecular formula C15H9NO and a molecular weight of 219.24 g/mol. Its IUPAC name is 17-oxa-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 17-oxa-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 138661052 |
| Molecular Formula | C15H9NO |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 17-oxa-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | c1ccc2c(c1)ccc1c3ncccc3oc21 |
| InChI | InChI=1S/C15H9NO/c1-2-5-11-10(4-1)7-8-12-14-13(17-15(11)12)6-3-9-16-14/h1-9H |
| InChIKey | LBMVTPKSQSZQHV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |