C15H8BNO — CID 174063651
CID 174063651 (PubChem CID 174063651) has the molecular formula C15H8BNO and a molecular weight of 229.05 g/mol.
| Compound Name | CID 174063651 |
|---|---|
| PubChem CID | 174063651 |
| Molecular Formula | C15H8BNO |
| Molecular Weight | 229.05 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | — |
| SMILES | [B]c1ccnc2c1oc1ccc3ccccc3c12 |
| InChI | InChI=1S/C15H8BNO/c16-11-7-8-17-14-13-10-4-2-1-3-9(10)5-6-12(13)18-15(11)14/h1-8H |
| InChIKey | RCWNVEAFAOQOKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.05 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|