C19H11NO — CID 14690181
3-oxa-12-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14,16,18,20-decaene (PubChem CID 14690181) has the molecular formula C19H11NO and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-oxa-12-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14,16,18,20-decaene.
| Compound Name | 3-oxa-12-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 14690181 |
| Molecular Formula | C19H11NO |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-oxa-12-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14,16,18,20-decaene |
| SMILES | c1ccc2c(c1)ccc1c2ncc2c3ccccc3oc21 |
| InChI | InChI=1S/C19H11NO/c1-2-6-13-12(5-1)9-10-15-18(13)20-11-16-14-7-3-4-8-17(14)21-19(15)16/h1-11H |
| InChIKey | SXIVHWKBRDBPDE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|