C13H8N2O — CID 118262872
16-oxa-5,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,3,6,8,10,12,14-heptaene (PubChem CID 118262872) has the molecular formula C13H8N2O and a molecular weight of 208.22 g/mol. Its IUPAC name is 16-oxa-5,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,3,6,8,10,12,14-heptaene.
| Compound Name | 16-oxa-5,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,3,6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 118262872 |
| Molecular Formula | C13H8N2O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 16-oxa-5,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,3,6,8,10,12,14-heptaene |
| SMILES | c1ccc2c(c1)oc1c3cc[nH]c3ncc21 |
| InChI | InChI=1S/C13H8N2O/c1-2-4-11-8(3-1)10-7-15-13-9(5-6-14-13)12(10)16-11/h1-7H,(H,14,15) |
| InChIKey | LEUHRYWDNMJCGE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |