C11H9NO — CID 130318214
3-methyl-2H-[1]benzofuro[2,3-c]pyrrole (PubChem CID 130318214) has the molecular formula C11H9NO and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-methyl-2H-[1]benzofuro[2,3-c]pyrrole.
| Compound Name | 3-methyl-2H-[1]benzofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 130318214 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3-methyl-2H-[1]benzofuro[2,3-c]pyrrole |
| SMILES | Cc1[nH]cc2c1oc1ccccc12 |
| InChI | InChI=1S/C11H9NO/c1-7-11-9(6-12-7)8-4-2-3-5-10(8)13-11/h2-6,12H,1H3 |
| InChIKey | AATUEKGVBQOALR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |