C22H27NO — CID 144831127
2-dibenzofuran-4-yl-4-methyl-1,2-dihydropyridine;ethane (PubChem CID 144831127) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-4-methyl-1,2-dihydropyridine;ethane.
| Compound Name | 2-dibenzofuran-4-yl-4-methyl-1,2-dihydropyridine;ethane |
|---|---|
| PubChem CID | 144831127 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-dibenzofuran-4-yl-4-methyl-1,2-dihydropyridine;ethane |
| SMILES | CC.CC.CC1=CC(c2cccc3c2oc2ccccc23)NC=C1 |
| InChI | InChI=1S/C18H15NO.2C2H6/c1-12-9-10-19-16(11-12)15-7-4-6-14-13-5-2-3-8-17(13)20-18(14)15;2*1-2/h2-11,16,19H,1H3;2*1-2H3 |
| InChIKey | CEPYAANAYRWIDO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |