C19H17NO — CID 144831133
2-dibenzofuran-4-yl-1,5-dimethyl-2H-pyridine (PubChem CID 144831133) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-1,5-dimethyl-2H-pyridine.
| Compound Name | 2-dibenzofuran-4-yl-1,5-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 144831133 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-dibenzofuran-4-yl-1,5-dimethyl-2H-pyridine |
| SMILES | CC1=CN(C)C(c2cccc3c2oc2ccccc23)C=C1 |
| InChI | InChI=1S/C19H17NO/c1-13-10-11-17(20(2)12-13)16-8-5-7-15-14-6-3-4-9-18(14)21-19(15)16/h3-12,17H,1-2H3 |
| InChIKey | SNXWFCCTSZCAGP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |