C20H20N2O — CID 167206557
(2R,6R)-2,3-dimethyl-7-(3-methyldibenzofuran-4-yl)-3,7-diazabicyclo[4.1.0]hept-4-ene (PubChem CID 167206557) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (2R,6R)-2,3-dimethyl-7-(3-methyldibenzofuran-4-yl)-3,7-diazabicyclo[4.1.0]hept-4-ene.
| Compound Name | (2R,6R)-2,3-dimethyl-7-(3-methyldibenzofuran-4-yl)-3,7-diazabicyclo[4.1.0]hept-4-ene |
|---|---|
| PubChem CID | 167206557 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2R,6R)-2,3-dimethyl-7-(3-methyldibenzofuran-4-yl)-3,7-diazabicyclo[4.1.0]hept-4-ene |
| SMILES | Cc1ccc2c(oc3ccccc32)c1N1C2[C@@H](C)N(C)C=C[C@H]21 |
| InChI | InChI=1S/C20H20N2O/c1-12-8-9-15-14-6-4-5-7-17(14)23-20(15)18(12)22-16-10-11-21(3)13(2)19(16)22/h4-11,13,16,19H,1-3H3/t13-,16-,19?,22?/m1/s1 |
| InChIKey | LPVAAFZXSKRHQQ-YGAQVDTQSA-N |
| XLogP | 4.30 |
| TPSA | 19.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|