C18H19IN2O — CID 170140733
(2R)-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-1,2-dihydroimidazol-1-ium iodide (PubChem CID 170140733) has the molecular formula C18H19IN2O and a molecular weight of 406.27 g/mol. Its IUPAC name is (2R)-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-1,2-dihydroimidazol-1-ium iodide.
| Compound Name | (2R)-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-1,2-dihydroimidazol-1-ium iodide |
|---|---|
| PubChem CID | 170140733 |
| Molecular Formula | C18H19IN2O |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (2R)-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-1,2-dihydroimidazol-1-ium iodide |
| SMILES | Cc1ccc2c(oc3ccccc32)c1N1C=C[NH+](C)[C@@H]1C.[I-] |
| InChI | InChI=1S/C18H18N2O.HI/c1-12-8-9-15-14-6-4-5-7-16(14)21-18(15)17(12)20-11-10-19(3)13(20)2;/h4-11,13H,1-3H3;1H/t13-;/m0./s1 |
| InChIKey | FIVCRTCYQUXCNX-ZOWNYOTGSA-N |
| XLogP | 0.05 |
| TPSA | 20.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|