C35H42N2O — CID 140723613
(2R)-4-[2,6-dimethyl-4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-2,3-dimethyl-1-(3-methyldibenzofuran-4-yl)-2H-imidazole (PubChem CID 140723613) has the molecular formula C35H42N2O and a molecular weight of 506.73 g/mol. Its IUPAC name is (2R)-4-[2,6-dimethyl-4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-2,3-dimethyl-1-(3-methyldibenzofuran-4-yl)-2H-imidazole.
| Compound Name | (2R)-4-[2,6-dimethyl-4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-2,3-dimethyl-1-(3-methyldibenzofuran-4-yl)-2H-imidazole |
|---|---|
| PubChem CID | 140723613 |
| Molecular Formula | C35H42N2O |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | (2R)-4-[2,6-dimethyl-4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-2,3-dimethyl-1-(3-methyldibenzofuran-4-yl)-2H-imidazole |
| SMILES | Cc1cc(C2C(C)C(C)C(C)C2C)cc(C)c1C1=CN(c2c(C)ccc3c2oc2ccccc23)[C@H](C)N1C |
| InChI | InChI=1S/C35H42N2O/c1-19-14-15-29-28-12-10-11-13-31(28)38-35(29)34(19)37-18-30(36(9)26(37)8)32-20(2)16-27(17-21(32)3)33-24(6)22(4)23(5)25(33)7/h10-18,22-26,33H,1-9H3/t22?,23?,24?,25?,26-,33?/m1/s1 |
| InChIKey | VMTFSQIVUSIHFF-FWMNCGHESA-N |
| XLogP | 9.25 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |