C29H32N2O — CID 167400605
CID 167400605 (PubChem CID 167400605) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol.
| Compound Name | CID 167400605 |
|---|---|
| PubChem CID | 167400605 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(c2c(C(C)C)cccc2C(C)C)CCN1c1c(C)ccc2c1oc1ccccc12 |
| InChI | InChI=1S/C29H32N2O/c1-18(2)22-11-9-12-23(19(3)4)28(22)31-17-16-30(21(31)6)27-20(5)14-15-25-24-10-7-8-13-26(24)32-29(25)27/h7-15,18-19H,6,16-17H2,1-5H3 |
| InChIKey | XLVJSNJMXHCCDJ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |