C22H18N2O — CID 140884078
CID 140884078 (PubChem CID 140884078) has the molecular formula C22H18N2O and a molecular weight of 329.42 g/mol.
| Compound Name | CID 140884078 |
|---|---|
| PubChem CID | 140884078 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])N1[C]([CH2])N(c2c(C)ccc3c2oc2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C22H18N2O/c1-14-12-13-17-16-8-4-7-11-20(16)25-22(17)21(14)24-15(2)23(3)18-9-5-6-10-19(18)24/h4-13H,2H2,1,3H3/i3D3 |
| InChIKey | RXWYKRFLSKCNCD-HPRDVNIFSA-N |
| XLogP | 5.81 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |