C23H21N3O — CID 140884046
CID 140884046 (PubChem CID 140884046) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol.
| Compound Name | CID 140884046 |
|---|---|
| PubChem CID | 140884046 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(c2c(C)ccc3c2oc2ccccc23)c2cccnc2N1C(C)C |
| InChI | InChI=1S/C23H21N3O/c1-14(2)25-16(4)26(19-9-7-13-24-23(19)25)21-15(3)11-12-18-17-8-5-6-10-20(17)27-22(18)21/h5-14H,4H2,1-3H3 |
| InChIKey | XOQQVOIUCZPLGY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |