C23H22N4O — CID 140884132
CID 140884132 (PubChem CID 140884132) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol.
| Compound Name | CID 140884132 |
|---|---|
| PubChem CID | 140884132 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(c2c(C)ccc3c2oc2nc(C)ccc23)c2cccnc2N1C(C)C |
| InChI | InChI=1S/C23H22N4O/c1-13(2)26-16(5)27(19-7-6-12-24-22(19)26)20-14(3)8-10-17-18-11-9-15(4)25-23(18)28-21(17)20/h6-13H,5H2,1-4H3 |
| InChIKey | VANKSXFGRLURFR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |