C20H17N5O — CID 140884084
CID 140884084 (PubChem CID 140884084) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol.
| Compound Name | CID 140884084 |
|---|---|
| PubChem CID | 140884084 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(C)c2nccnc2N1c1c(C)ccc2c1oc1nc(C)ccc12 |
| InChI | InChI=1S/C20H17N5O/c1-11-5-7-14-15-8-6-12(2)23-20(15)26-17(14)16(11)25-13(3)24(4)18-19(25)22-10-9-21-18/h5-10H,3H2,1-2,4H3 |
| InChIKey | TWYDXJXGXQTSBH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |