About CID 140884066
CID 140884066 (PubChem CID 140884066) has the molecular formula C22H26N2O
and a molecular weight of 334.46 g/mol.
Molecular Properties
| Compound Name | CID 140884066 |
| PubChem CID | 140884066 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(c2c(C)ccc3c2oc2nc(C)ccc23)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C22H26N2O/c1-13-8-10-16-17-11-9-14(2)23-20(17)25-19(16)18(13)24-15(3)21(4,5)12-22(24,6)7/h8-11H,3,12H2,1-2,4-7H3 |
| InChIKey | NLNICLVLRQYJMH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 140884066 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140884066?
The IUPAC name of CID 140884066 (CID 140884066) is not available.
What is the SMILES notation for CID 140884066?
The canonical SMILES for CID 140884066 is [CH2][C]1N(c2c(C)ccc3c2oc2nc(C)ccc23)C(C)(C)CC1(C)C.
What is the InChIKey of CID 140884066?
The InChIKey is NLNICLVLRQYJMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O/c1-13-8-10-16-17-11-9-14(2)23-20(17)25-19(16)18(13)24-15(3)21(4,5)12-22(24,6)7/h8-11H,3,12H2,1-2,4-7H3.
What are the key properties of CID 140884066?
CID 140884066 has a molecular weight of 334.46 g/mol, XLogP of 5.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140884066 is sourced from PubChem (CID 140884066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).