C22H26N2O — CID 140884066
CID 140884066 (PubChem CID 140884066) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol.
| Compound Name | CID 140884066 |
|---|---|
| PubChem CID | 140884066 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(c2c(C)ccc3c2oc2nc(C)ccc23)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C22H26N2O/c1-13-8-10-16-17-11-9-14(2)23-20(17)25-19(16)18(13)24-15(3)21(4,5)12-22(24,6)7/h8-11H,3,12H2,1-2,4-7H3 |
| InChIKey | NLNICLVLRQYJMH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |