C24H30N2O — CID 162296034
2,7-dimethyl-8-(1,3,4,7,7-pentamethyl-2-azabicyclo[2.2.1]heptan-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 162296034) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 2,7-dimethyl-8-(1,3,4,7,7-pentamethyl-2-azabicyclo[2.2.1]heptan-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,7-dimethyl-8-(1,3,4,7,7-pentamethyl-2-azabicyclo[2.2.1]heptan-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 162296034 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2,7-dimethyl-8-(1,3,4,7,7-pentamethyl-2-azabicyclo[2.2.1]heptan-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(N3C(C)C4(C)CCC3(C)C4(C)C)c(C)ccc12 |
| InChI | InChI=1S/C24H30N2O/c1-14-8-10-17-18-11-9-15(2)25-21(18)27-20(17)19(14)26-16(3)23(6)12-13-24(26,7)22(23,4)5/h8-11,16H,12-13H2,1-7H3 |
| InChIKey | ODFRZDAFZTVKAX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |