C24H23N3O — CID 162296382
2,7-dimethyl-8-(11-methyl-1,10-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-10-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 162296382) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 2,7-dimethyl-8-(11-methyl-1,10-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-10-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,7-dimethyl-8-(11-methyl-1,10-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-10-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 162296382 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2,7-dimethyl-8-(11-methyl-1,10-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-10-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(N3C4Cc5ccccc5N(C4)C3C)c(C)ccc12 |
| InChI | InChI=1S/C24H23N3O/c1-14-8-10-19-20-11-9-15(2)25-24(20)28-23(19)22(14)27-16(3)26-13-18(27)12-17-6-4-5-7-21(17)26/h4-11,16,18H,12-13H2,1-3H3 |
| InChIKey | JWWBVDZTSAJZKJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |